C11H10N2O6S — CID 63646594
2-[carboxymethyl-(2-cyanophenyl)sulfonylamino]acetic acid (PubChem CID 63646594) has the molecular formula C11H10N2O6S and a molecular weight of 298.28 g/mol. Its IUPAC name is 2-[carboxymethyl-(2-cyanophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[carboxymethyl-(2-cyanophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 63646594 |
| Molecular Formula | C11H10N2O6S |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-[carboxymethyl-(2-cyanophenyl)sulfonylamino]acetic acid |
| SMILES | N#Cc1ccccc1S(=O)(=O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H10N2O6S/c12-5-8-3-1-2-4-9(8)20(18,19)13(6-10(14)15)7-11(16)17/h1-4H,6-7H2,(H,14,15)(H,16,17) |
| InChIKey | UAPUQSLVPSZUOQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |