C20H18N2O2S2 — CID 9302359
2-cyano-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 9302359) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2-cyano-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-cyano-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 9302359 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-cyano-N-(2-phenylethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)N(CCc1ccccc1)Cc1cccs1 |
| InChI | InChI=1S/C20H18N2O2S2/c21-15-18-9-4-5-11-20(18)26(23,24)22(16-19-10-6-14-25-19)13-12-17-7-2-1-3-8-17/h1-11,14H,12-13,16H2 |
| InChIKey | VDIKBIKMIWJJIB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |