C18H17FN2O2S2 — CID 121084948
2-fluoro-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 121084948) has the molecular formula C18H17FN2O2S2 and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-fluoro-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121084948 |
| Molecular Formula | C18H17FN2O2S2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-fluoro-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccccc1F)N(CCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C18H17FN2O2S2/c19-17-7-1-2-8-18(17)25(22,23)21(11-9-16-6-4-12-24-16)14-15-5-3-10-20-13-15/h1-8,10,12-13H,9,11,14H2 |
| InChIKey | IPQDZMVXVGBUMC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |