C18H17BrN2O2S2 — CID 121085018
4-bromo-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 121085018) has the molecular formula C18H17BrN2O2S2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 4-bromo-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121085018 |
| Molecular Formula | C18H17BrN2O2S2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 4-bromo-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N(CCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C18H17BrN2O2S2/c19-16-5-7-18(8-6-16)25(22,23)21(11-9-17-4-2-12-24-17)14-15-3-1-10-20-13-15/h1-8,10,12-13H,9,11,14H2 |
| InChIKey | NFORKCCOCMBJLV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |