C14H15BrN2O2S — CID 80673646
N-benzyl-N-(2-bromoethyl)pyridine-3-sulfonamide (PubChem CID 80673646) has the molecular formula C14H15BrN2O2S and a molecular weight of 355.26 g/mol. Its IUPAC name is N-benzyl-N-(2-bromoethyl)pyridine-3-sulfonamide.
| Compound Name | N-benzyl-N-(2-bromoethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 80673646 |
| Molecular Formula | C14H15BrN2O2S |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | N-benzyl-N-(2-bromoethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(c1cccnc1)N(CCBr)Cc1ccccc1 |
| InChI | InChI=1S/C14H15BrN2O2S/c15-8-10-17(12-13-5-2-1-3-6-13)20(18,19)14-7-4-9-16-11-14/h1-7,9,11H,8,10,12H2 |
| InChIKey | IACPRWWCDRRSED-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|