C23H26N2O3S — CID 141072849
N-benzyl-N-[[4-(3-hydroxybutan-2-yl)phenyl]methyl]pyridine-3-sulfonamide (PubChem CID 141072849) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-benzyl-N-[[4-(3-hydroxybutan-2-yl)phenyl]methyl]pyridine-3-sulfonamide.
| Compound Name | N-benzyl-N-[[4-(3-hydroxybutan-2-yl)phenyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 141072849 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-benzyl-N-[[4-(3-hydroxybutan-2-yl)phenyl]methyl]pyridine-3-sulfonamide |
| SMILES | CC(O)C(C)c1ccc(CN(Cc2ccccc2)S(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-18(19(2)26)22-12-10-21(11-13-22)17-25(16-20-7-4-3-5-8-20)29(27,28)23-9-6-14-24-15-23/h3-15,18-19,26H,16-17H2,1-2H3 |
| InChIKey | VBUPNFNCMMPCPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |