C21H22N4O6S2 — CID 177380872
2-[3-[[pyridin-3-ylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]anilino]acetic acid (PubChem CID 177380872) has the molecular formula C21H22N4O6S2 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[3-[[pyridin-3-ylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]anilino]acetic acid.
| Compound Name | 2-[3-[[pyridin-3-ylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]anilino]acetic acid |
|---|---|
| PubChem CID | 177380872 |
| Molecular Formula | C21H22N4O6S2 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-[3-[[pyridin-3-ylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]anilino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(CN(Cc2cccc(NCC(=O)O)c2)S(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C21H22N4O6S2/c22-32(28,29)19-8-6-16(7-9-19)14-25(33(30,31)20-5-2-10-23-12-20)15-17-3-1-4-18(11-17)24-13-21(26)27/h1-12,24H,13-15H2,(H,26,27)(H2,22,28,29) |
| InChIKey | DKYXZFLPCTUSLD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 159.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |