C25H28N2NaO5S — CID 66921358
CID 66921358 (PubChem CID 66921358) has the molecular formula C25H28N2NaO5S and a molecular weight of 491.57 g/mol.
| Compound Name | CID 66921358 |
|---|---|
| PubChem CID | 66921358 |
| Molecular Formula | C25H28N2NaO5S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(CN(Cc2cccc(OCC(=O)O)c2)S(=O)(=O)c2cccnc2)cc1.[Na] |
| InChI | InChI=1S/C25H28N2O5S.Na/c1-25(2,3)21-11-9-19(10-12-21)16-27(33(30,31)23-8-5-13-26-15-23)17-20-6-4-7-22(14-20)32-18-24(28)29;/h4-15H,16-18H2,1-3H3,(H,28,29); |
| InChIKey | LMHFDTZFSFNOJH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |