C17H20N2O7S2 — CID 177380857
2-[3-[[methylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]phenoxy]acetic acid (PubChem CID 177380857) has the molecular formula C17H20N2O7S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[3-[[methylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[[methylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 177380857 |
| Molecular Formula | C17H20N2O7S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 2-[3-[[methylsulfonyl-[(4-sulfamoylphenyl)methyl]amino]methyl]phenoxy]acetic acid |
| SMILES | CS(=O)(=O)N(Cc1ccc(S(N)(=O)=O)cc1)Cc1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C17H20N2O7S2/c1-27(22,23)19(10-13-5-7-16(8-6-13)28(18,24)25)11-14-3-2-4-15(9-14)26-12-17(20)21/h2-9H,10-12H2,1H3,(H,20,21)(H2,18,24,25) |
| InChIKey | LRZJDNUNCFXTOJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 144.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |