C18H22N2O3S — CID 46998054
4-[[[3-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]benzenesulfonamide (PubChem CID 46998054) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is 4-[[[3-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[3-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46998054 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[[[3-(2-methylprop-2-enoxy)phenyl]methylamino]methyl]benzenesulfonamide |
| SMILES | C=C(C)COc1cccc(CNCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H22N2O3S/c1-14(2)13-23-17-5-3-4-16(10-17)12-20-11-15-6-8-18(9-7-15)24(19,21)22/h3-10,20H,1,11-13H2,2H3,(H2,19,21,22) |
| InChIKey | BEGRFGLTYUNDQJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|