C14H14FN3O4S — CID 167944542
3-[(5-fluoro-3-pyridinyl)sulfonyl-(pyridin-3-ylmethyl)amino]propanoic acid (PubChem CID 167944542) has the molecular formula C14H14FN3O4S and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-[(5-fluoro-3-pyridinyl)sulfonyl-(pyridin-3-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[(5-fluoro-3-pyridinyl)sulfonyl-(pyridin-3-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167944542 |
| Molecular Formula | C14H14FN3O4S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 3-[(5-fluoro-3-pyridinyl)sulfonyl-(pyridin-3-ylmethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1cccnc1)S(=O)(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C14H14FN3O4S/c15-12-6-13(9-17-8-12)23(21,22)18(5-3-14(19)20)10-11-2-1-4-16-7-11/h1-2,4,6-9H,3,5,10H2,(H,19,20) |
| InChIKey | RDCWOCRKXRYQLQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |