C19H19ClN2O2S2 — CID 121084985
3-chloro-2-methyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide (PubChem CID 121084985) has the molecular formula C19H19ClN2O2S2 and a molecular weight of 406.96 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121084985 |
| Molecular Formula | C19H19ClN2O2S2 |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 3-chloro-2-methyl-N-(pyridin-3-ylmethyl)-N-(2-thiophen-2-ylethyl)benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N(CCc1cccs1)Cc1cccnc1 |
| InChI | InChI=1S/C19H19ClN2O2S2/c1-15-18(20)7-2-8-19(15)26(23,24)22(11-9-17-6-4-12-25-17)14-16-5-3-10-21-13-16/h2-8,10,12-13H,9,11,14H2,1H3 |
| InChIKey | UXGMDAUMXJFMBX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |