C19H16ClN3O2S — CID 3397020
8-chloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)naphthalene-1-sulfonamide (PubChem CID 3397020) has the molecular formula C19H16ClN3O2S and a molecular weight of 385.88 g/mol. Its IUPAC name is 8-chloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)naphthalene-1-sulfonamide.
| Compound Name | 8-chloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 3397020 |
| Molecular Formula | C19H16ClN3O2S |
| Molecular Weight | 385.88 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 8-chloro-N-(2-cyanoethyl)-N-(pyridin-3-ylmethyl)naphthalene-1-sulfonamide |
| SMILES | N#CCCN(Cc1cccnc1)S(=O)(=O)c1cccc2cccc(Cl)c12 |
| InChI | InChI=1S/C19H16ClN3O2S/c20-17-8-1-6-16-7-2-9-18(19(16)17)26(24,25)23(12-4-10-21)14-15-5-3-11-22-13-15/h1-3,5-9,11,13H,4,12,14H2 |
| InChIKey | QOIOZGQBJMFREF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |