C13H12ClN5 — CID 62338506
3-[(2-chloropyrimidin-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile (PubChem CID 62338506) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 3-[(2-chloropyrimidin-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[(2-chloropyrimidin-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 62338506 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-[(2-chloropyrimidin-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1cccnc1)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C13H12ClN5/c14-13-17-7-4-12(18-13)19(8-2-5-15)10-11-3-1-6-16-9-11/h1,3-4,6-7,9H,2,8,10H2 |
| InChIKey | PEWIVUASBNPEHS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 65.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |