C16H16ClN3 — CID 28946190
3-[2-(chloromethyl)-N-(pyridin-3-ylmethyl)anilino]propanenitrile (PubChem CID 28946190) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is 3-[2-(chloromethyl)-N-(pyridin-3-ylmethyl)anilino]propanenitrile.
| Compound Name | 3-[2-(chloromethyl)-N-(pyridin-3-ylmethyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 28946190 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3-[2-(chloromethyl)-N-(pyridin-3-ylmethyl)anilino]propanenitrile |
| SMILES | N#CCCN(Cc1cccnc1)c1ccccc1CCl |
| InChI | InChI=1S/C16H16ClN3/c17-11-15-6-1-2-7-16(15)20(10-4-8-18)13-14-5-3-9-19-12-14/h1-3,5-7,9,12H,4,10-11,13H2 |
| InChIKey | SQYXKUYHRFKWGB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|