C17H18ClN3 — CID 62129965
3-[4-(chloromethyl)-3-methyl-N-(pyridin-3-ylmethyl)anilino]propanenitrile (PubChem CID 62129965) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is 3-[4-(chloromethyl)-3-methyl-N-(pyridin-3-ylmethyl)anilino]propanenitrile.
| Compound Name | 3-[4-(chloromethyl)-3-methyl-N-(pyridin-3-ylmethyl)anilino]propanenitrile |
|---|---|
| PubChem CID | 62129965 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-[4-(chloromethyl)-3-methyl-N-(pyridin-3-ylmethyl)anilino]propanenitrile |
| SMILES | Cc1cc(N(CCC#N)Cc2cccnc2)ccc1CCl |
| InChI | InChI=1S/C17H18ClN3/c1-14-10-17(6-5-16(14)11-18)21(9-3-7-19)13-15-4-2-8-20-12-15/h2,4-6,8,10,12H,3,9,11,13H2,1H3 |
| InChIKey | XMBFOMBFZWGAPM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|