C13H16N6 — CID 103077826
3-[(4-amino-1-methylpyrazol-3-yl)-(pyridin-3-ylmethyl)amino]propanenitrile (PubChem CID 103077826) has the molecular formula C13H16N6 and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-[(4-amino-1-methylpyrazol-3-yl)-(pyridin-3-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[(4-amino-1-methylpyrazol-3-yl)-(pyridin-3-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 103077826 |
| Molecular Formula | C13H16N6 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3-[(4-amino-1-methylpyrazol-3-yl)-(pyridin-3-ylmethyl)amino]propanenitrile |
| SMILES | Cn1cc(N)c(N(CCC#N)Cc2cccnc2)n1 |
| InChI | InChI=1S/C13H16N6/c1-18-10-12(15)13(17-18)19(7-3-5-14)9-11-4-2-6-16-8-11/h2,4,6,8,10H,3,7,9,15H2,1H3 |
| InChIKey | NHSRUUROMNKVIP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |