C12H14N6 — CID 114991577
3-[(5-amino-1H-pyrazol-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile (PubChem CID 114991577) has the molecular formula C12H14N6 and a molecular weight of 242.29 g/mol. Its IUPAC name is 3-[(5-amino-1H-pyrazol-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile.
| Compound Name | 3-[(5-amino-1H-pyrazol-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile |
|---|---|
| PubChem CID | 114991577 |
| Molecular Formula | C12H14N6 |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-[(5-amino-1H-pyrazol-4-yl)-(pyridin-3-ylmethyl)amino]propanenitrile |
| SMILES | N#CCCN(Cc1cccnc1)c1cn[nH]c1N |
| InChI | InChI=1S/C12H14N6/c13-4-2-6-18(11-8-16-17-12(11)14)9-10-3-1-5-15-7-10/h1,3,5,7-8H,2,6,9H2,(H3,14,16,17) |
| InChIKey | AHCIRKLEOXYKGG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |