C16H13FN4 — CID 63669035
2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-5-fluorobenzonitrile (PubChem CID 63669035) has the molecular formula C16H13FN4 and a molecular weight of 280.31 g/mol. Its IUPAC name is 2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-5-fluorobenzonitrile.
| Compound Name | 2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 63669035 |
| Molecular Formula | C16H13FN4 |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[2-cyanoethyl(pyridin-3-ylmethyl)amino]-5-fluorobenzonitrile |
| SMILES | N#CCCN(Cc1cccnc1)c1ccc(F)cc1C#N |
| InChI | InChI=1S/C16H13FN4/c17-15-4-5-16(14(9-15)10-19)21(8-2-6-18)12-13-3-1-7-20-11-13/h1,3-5,7,9,11H,2,8,12H2 |
| InChIKey | VPZOJUHYLILXDI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |