C16H19ClN2O5S2 — CID 71913435
2-chloro-N-(3-hydroxypropyl)-5-methylsulfonyl-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 71913435) has the molecular formula C16H19ClN2O5S2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxypropyl)-5-methylsulfonyl-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(3-hydroxypropyl)-5-methylsulfonyl-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71913435 |
| Molecular Formula | C16H19ClN2O5S2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 2-chloro-N-(3-hydroxypropyl)-5-methylsulfonyl-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(S(=O)(=O)N(CCCO)Cc2cccnc2)c1 |
| InChI | InChI=1S/C16H19ClN2O5S2/c1-25(21,22)14-5-6-15(17)16(10-14)26(23,24)19(8-3-9-20)12-13-4-2-7-18-11-13/h2,4-7,10-11,20H,3,8-9,12H2,1H3 |
| InChIKey | IZCIJYSDKWVGBP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |