C16H16ClF3N2O2S — CID 60530970
2-chloro-N-propan-2-yl-N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 60530970) has the molecular formula C16H16ClF3N2O2S and a molecular weight of 392.83 g/mol. Its IUPAC name is 2-chloro-N-propan-2-yl-N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-propan-2-yl-N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60530970 |
| Molecular Formula | C16H16ClF3N2O2S |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 2-chloro-N-propan-2-yl-N-(pyridin-3-ylmethyl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)N(Cc1cccnc1)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H16ClF3N2O2S/c1-11(2)22(10-12-4-3-7-21-9-12)25(23,24)15-8-13(16(18,19)20)5-6-14(15)17/h3-9,11H,10H2,1-2H3 |
| InChIKey | DINWWGIPRAWENM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |