C19H14ClF3N2O2S — CID 52634275
N-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 52634275) has the molecular formula C19H14ClF3N2O2S and a molecular weight of 426.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 52634275 |
| Molecular Formula | C19H14ClF3N2O2S |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | N-(4-chlorophenyl)-N-(pyridin-3-ylmethyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N(Cc1cccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClF3N2O2S/c20-16-5-7-17(8-6-16)25(13-14-2-1-11-24-12-14)28(26,27)18-9-3-15(4-10-18)19(21,22)23/h1-12H,13H2 |
| InChIKey | QDWVXAZPLFHDLV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |