C15H22ClF3N2O2S — CID 3528675
2-chloro-N-[2-(diethylamino)ethyl]-N-ethyl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 3528675) has the molecular formula C15H22ClF3N2O2S and a molecular weight of 386.87 g/mol. Its IUPAC name is 2-chloro-N-[2-(diethylamino)ethyl]-N-ethyl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[2-(diethylamino)ethyl]-N-ethyl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3528675 |
| Molecular Formula | C15H22ClF3N2O2S |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-chloro-N-[2-(diethylamino)ethyl]-N-ethyl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCN(CC)CCN(CC)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H22ClF3N2O2S/c1-4-20(5-2)9-10-21(6-3)24(22,23)14-11-12(15(17,18)19)7-8-13(14)16/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | PHTUUGLCLQTPMN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |