C14H19ClF3NO3S — CID 74229500
2-chloro-N-(2-hydroxyethyl)-N-pentyl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 74229500) has the molecular formula C14H19ClF3NO3S and a molecular weight of 373.82 g/mol. Its IUPAC name is 2-chloro-N-(2-hydroxyethyl)-N-pentyl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(2-hydroxyethyl)-N-pentyl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 74229500 |
| Molecular Formula | C14H19ClF3NO3S |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-chloro-N-(2-hydroxyethyl)-N-pentyl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCCCCN(CCO)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C14H19ClF3NO3S/c1-2-3-4-7-19(8-9-20)23(21,22)13-10-11(14(16,17)18)5-6-12(13)15/h5-6,10,20H,2-4,7-9H2,1H3 |
| InChIKey | IESRIXNJRQDDBI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|