C12H16BrCl2NO2S — CID 80669261
N-(2-bromoethyl)-N-butyl-2,5-dichlorobenzenesulfonamide (PubChem CID 80669261) has the molecular formula C12H16BrCl2NO2S and a molecular weight of 389.14 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-butyl-2,5-dichlorobenzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-N-butyl-2,5-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 80669261 |
| Molecular Formula | C12H16BrCl2NO2S |
| Molecular Weight | 389.14 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | N-(2-bromoethyl)-N-butyl-2,5-dichlorobenzenesulfonamide |
| SMILES | CCCCN(CCBr)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H16BrCl2NO2S/c1-2-3-7-16(8-6-13)19(17,18)12-9-10(14)4-5-11(12)15/h4-5,9H,2-3,6-8H2,1H3 |
| InChIKey | WFMJDTCVLBKCQO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.14 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|