C14H20Cl2N2O3S — CID 4233254
N-butyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide (PubChem CID 4233254) has the molecular formula C14H20Cl2N2O3S and a molecular weight of 367.30 g/mol. Its IUPAC name is N-butyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide.
| Compound Name | N-butyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 4233254 |
| Molecular Formula | C14H20Cl2N2O3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-butyl-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide |
| SMILES | CCCCNC(=O)CN(CC)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O3S/c1-3-5-8-17-14(19)10-18(4-2)22(20,21)13-9-11(15)6-7-12(13)16/h6-7,9H,3-5,8,10H2,1-2H3,(H,17,19) |
| InChIKey | GDMSHQJQGHNEMS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|