C18H24Cl2N2O3S — CID 45371959
N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide (PubChem CID 45371959) has the molecular formula C18H24Cl2N2O3S and a molecular weight of 419.37 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide |
|---|---|
| PubChem CID | 45371959 |
| Molecular Formula | C18H24Cl2N2O3S |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-ethylamino]acetamide |
| SMILES | CCN(CC(=O)NCCC1=CCCCC1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H24Cl2N2O3S/c1-2-22(26(24,25)17-12-15(19)8-9-16(17)20)13-18(23)21-11-10-14-6-4-3-5-7-14/h6,8-9,12H,2-5,7,10-11,13H2,1H3,(H,21,23) |
| InChIKey | BCRXFOXNQVWUMD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|