C20H27ClN2O4S — CID 92647652
2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide (PubChem CID 92647652) has the molecular formula C20H27ClN2O4S and a molecular weight of 426.97 g/mol. Its IUPAC name is 2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide.
| Compound Name | 2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 92647652 |
| Molecular Formula | C20H27ClN2O4S |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-(4-chloro-2-pyrrolidin-1-ylsulfonylphenoxy)-N-[2-(cyclohexen-1-yl)ethyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1S(=O)(=O)N1CCCC1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H27ClN2O4S/c21-17-8-9-18(19(14-17)28(25,26)23-12-4-5-13-23)27-15-20(24)22-11-10-16-6-2-1-3-7-16/h6,8-9,14H,1-5,7,10-13,15H2,(H,22,24) |
| InChIKey | LIULMLMPUSCGKM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|