C17H22Cl2N2O3S — CID 17027739
N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide (PubChem CID 17027739) has the molecular formula C17H22Cl2N2O3S and a molecular weight of 405.35 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 17027739 |
| Molecular Formula | C17H22Cl2N2O3S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(2,5-dichlorophenyl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(=O)NCCC1=CCCCC1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H22Cl2N2O3S/c1-21(25(23,24)16-11-14(18)7-8-15(16)19)12-17(22)20-10-9-13-5-3-2-4-6-13/h5,7-8,11H,2-4,6,9-10,12H2,1H3,(H,20,22) |
| InChIKey | CWPLNMQYFHALPT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|