C18H24Cl2N2O — CID 108993859
2-[2-(cyclohexen-1-yl)ethylamino]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide (PubChem CID 108993859) has the molecular formula C18H24Cl2N2O and a molecular weight of 355.31 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 108993859 |
| Molecular Formula | C18H24Cl2N2O |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-N-[2-(2,4-dichlorophenyl)ethyl]acetamide |
| SMILES | O=C(CNCCC1=CCCCC1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H24Cl2N2O/c19-16-7-6-15(17(20)12-16)9-11-22-18(23)13-21-10-8-14-4-2-1-3-5-14/h4,6-7,12,21H,1-3,5,8-11,13H2,(H,22,23) |
| InChIKey | XNGPDBOCQDQYAY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|