C19H29N3O3S — CID 113156112
N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(dimethylamino)-N-methylsulfonylanilino]acetamide (PubChem CID 113156112) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(dimethylamino)-N-methylsulfonylanilino]acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(dimethylamino)-N-methylsulfonylanilino]acetamide |
|---|---|
| PubChem CID | 113156112 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[4-(dimethylamino)-N-methylsulfonylanilino]acetamide |
| SMILES | CN(C)c1ccc(N(CC(=O)NCCC2=CCCCC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H29N3O3S/c1-21(2)17-9-11-18(12-10-17)22(26(3,24)25)15-19(23)20-14-13-16-7-5-4-6-8-16/h7,9-12H,4-6,8,13-15H2,1-3H3,(H,20,23) |
| InChIKey | WZHGFABZQHMHJC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|