C24H29FN2O4S — CID 126415843
N-[2-(cyclohexen-1-yl)ethyl]-2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)acetamide (PubChem CID 126415843) has the molecular formula C24H29FN2O4S and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126415843 |
| Molecular Formula | C24H29FN2O4S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCC2=CCCCC2)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H29FN2O4S/c1-2-31-22-12-10-21(11-13-22)27(32(29,30)23-14-8-20(25)9-15-23)18-24(28)26-17-16-19-6-4-3-5-7-19/h6,8-15H,2-5,7,16-18H2,1H3,(H,26,28) |
| InChIKey | HVKQHRHDOHSSSN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|