C19H23FN2O5S — CID 3380289
2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)-N-(2-methoxyethyl)acetamide (PubChem CID 3380289) has the molecular formula C19H23FN2O5S and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3380289 |
| Molecular Formula | C19H23FN2O5S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-(4-ethoxy-N-(4-fluorophenyl)sulfonylanilino)-N-(2-methoxyethyl)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)NCCOC)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H23FN2O5S/c1-3-27-17-8-6-16(7-9-17)22(14-19(23)21-12-13-26-2)28(24,25)18-10-4-15(20)5-11-18/h4-11H,3,12-14H2,1-2H3,(H,21,23) |
| InChIKey | BMZBTZWSSGYBMZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|