C15H24N2O5S — CID 19798440
2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 19798440) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 19798440 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC(=O)NCCOC)cc1 |
| InChI | InChI=1S/C15H24N2O5S/c1-4-17(12-15(18)16-10-11-21-3)23(19,20)14-8-6-13(7-9-14)22-5-2/h6-9H,4-5,10-12H2,1-3H3,(H,16,18) |
| InChIKey | YCJQIFOPZGPVQN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|