C17H25N5O4S2 — CID 100795670
2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100795670) has the molecular formula C17H25N5O4S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100795670 |
| Molecular Formula | C17H25N5O4S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 2-[(4-ethoxyphenyl)sulfonyl-ethylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC(=O)NCCSc2n[nH]c(C)n2)cc1 |
| InChI | InChI=1S/C17H25N5O4S2/c1-4-22(28(24,25)15-8-6-14(7-9-15)26-5-2)12-16(23)18-10-11-27-17-19-13(3)20-21-17/h6-9H,4-5,10-12H2,1-3H3,(H,18,23)(H,19,20,21) |
| InChIKey | UZPGIBFNTDEMCS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|