C22H27N5O4S2 — CID 100797688
2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100797688) has the molecular formula C22H27N5O4S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100797688 |
| Molecular Formula | C22H27N5O4S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-[benzyl-(4-ethoxyphenyl)sulfonylamino]-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)NCCSc2n[nH]c(C)n2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N5O4S2/c1-3-31-19-9-11-20(12-10-19)33(29,30)27(15-18-7-5-4-6-8-18)16-21(28)23-13-14-32-22-24-17(2)25-26-22/h4-12H,3,13-16H2,1-2H3,(H,23,28)(H,24,25,26) |
| InChIKey | ACBZAZSXBBRVEJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|