C26H27N5O4S2 — CID 100791093
2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100791093) has the molecular formula C26H27N5O4S2 and a molecular weight of 537.67 g/mol. Its IUPAC name is 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100791093 |
| Molecular Formula | C26H27N5O4S2 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCSc2n[nH]c(-c3ccccc3)n2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N5O4S2/c1-35-22-12-14-23(15-13-22)37(33,34)31(18-20-8-4-2-5-9-20)19-24(32)27-16-17-36-26-28-25(29-30-26)21-10-6-3-7-11-21/h2-15H,16-19H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | WRWRVNYVNAPLAP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|