C29H33N5O3S2 — CID 100795005
2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100795005) has the molecular formula C29H33N5O3S2 and a molecular weight of 563.75 g/mol. Its IUPAC name is 2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100795005 |
| Molecular Formula | C29H33N5O3S2 |
| Molecular Weight | 563.75 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | 2-[2-phenylethyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(CCc2ccccc2)CC(=O)NCCSc2n[nH]c(-c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C29H33N5O3S2/c1-21-18-22(2)27(23(3)19-21)39(36,37)34(16-14-24-10-6-4-7-11-24)20-26(35)30-15-17-38-29-31-28(32-33-29)25-12-8-5-9-13-25/h4-13,18-19H,14-17,20H2,1-3H3,(H,30,35)(H,31,32,33) |
| InChIKey | DEBHQTRDRVMMCB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.75 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|