C25H25N5O3S2 — CID 100789656
2-[benzenesulfonyl(benzyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100789656) has the molecular formula C25H25N5O3S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[benzenesulfonyl(benzyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[benzenesulfonyl(benzyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100789656 |
| Molecular Formula | C25H25N5O3S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | 2-[benzenesulfonyl(benzyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1ccccc1)NCCSc1n[nH]c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H25N5O3S2/c31-23(26-16-17-34-25-27-24(28-29-25)21-12-6-2-7-13-21)19-30(18-20-10-4-1-5-11-20)35(32,33)22-14-8-3-9-15-22/h1-15H,16-19H2,(H,26,31)(H,27,28,29) |
| InChIKey | GSXRIFNVNIXNKF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|