C24H29N5O3S2 — CID 100789838
2-[benzenesulfonyl(cyclohexyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100789838) has the molecular formula C24H29N5O3S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is 2-[benzenesulfonyl(cyclohexyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[benzenesulfonyl(cyclohexyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100789838 |
| Molecular Formula | C24H29N5O3S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 2-[benzenesulfonyl(cyclohexyl)amino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(C1CCCCC1)S(=O)(=O)c1ccccc1)NCCSc1n[nH]c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H29N5O3S2/c30-22(25-16-17-33-24-26-23(27-28-24)19-10-4-1-5-11-19)18-29(20-12-6-2-7-13-20)34(31,32)21-14-8-3-9-15-21/h1,3-5,8-11,14-15,20H,2,6-7,12-13,16-18H2,(H,25,30)(H,26,27,28) |
| InChIKey | XOJUGBPDMJNQNV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|