C25H24ClN5O3S2 — CID 100788288
2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100788288) has the molecular formula C25H24ClN5O3S2 and a molecular weight of 542.09 g/mol. Its IUPAC name is 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100788288 |
| Molecular Formula | C25H24ClN5O3S2 |
| Molecular Weight | 542.09 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 2-[4-[(4-chlorophenyl)sulfonyl-methylamino]phenyl]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | CN(c1ccc(CC(=O)NCCSc2n[nH]c(-c3ccccc3)n2)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClN5O3S2/c1-31(36(33,34)22-13-9-20(26)10-14-22)21-11-7-18(8-12-21)17-23(32)27-15-16-35-25-28-24(29-30-25)19-5-3-2-4-6-19/h2-14H,15-17H2,1H3,(H,27,32)(H,28,29,30) |
| InChIKey | QBKYLEBSLWIBSG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.09 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|