C20H22ClN5O3S2 — CID 133255226
3-(4-chlorophenyl)-3-(methanesulfonamido)-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]propanamide (PubChem CID 133255226) has the molecular formula C20H22ClN5O3S2 and a molecular weight of 480.02 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(methanesulfonamido)-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-3-(methanesulfonamido)-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 133255226 |
| Molecular Formula | C20H22ClN5O3S2 |
| Molecular Weight | 480.02 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(methanesulfonamido)-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]propanamide |
| SMILES | CS(=O)(=O)NC(CC(=O)NCCSc1n[nH]c(-c2ccccc2)n1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN5O3S2/c1-31(28,29)26-17(14-7-9-16(21)10-8-14)13-18(27)22-11-12-30-20-23-19(24-25-20)15-5-3-2-4-6-15/h2-10,17,26H,11-13H2,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | LKDOZWJZOOLQLX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.02 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|