C15H21N5O4S2 — CID 133255364
3-(methanesulfonamido)-3-(4-methoxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]propanamide (PubChem CID 133255364) has the molecular formula C15H21N5O4S2 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-(methanesulfonamido)-3-(4-methoxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]propanamide.
| Compound Name | 3-(methanesulfonamido)-3-(4-methoxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 133255364 |
| Molecular Formula | C15H21N5O4S2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 3-(methanesulfonamido)-3-(4-methoxyphenyl)-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]propanamide |
| SMILES | COc1ccc(C(CC(=O)NCCSc2ncn[nH]2)NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H21N5O4S2/c1-24-12-5-3-11(4-6-12)13(20-26(2,22)23)9-14(21)16-7-8-25-15-17-10-18-19-15/h3-6,10,13,20H,7-9H2,1-2H3,(H,16,21)(H,17,18,19) |
| InChIKey | QGEZEPKYQNXAQE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|