C27H29N5O5S2 — CID 100791310
2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide (PubChem CID 100791310) has the molecular formula C27H29N5O5S2 and a molecular weight of 567.69 g/mol. Its IUPAC name is 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide.
| Compound Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100791310 |
| Molecular Formula | C27H29N5O5S2 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 2-[benzyl-(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)NCCSc2n[nH]c(-c3ccccc3)n2)Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C27H29N5O5S2/c1-36-23-14-13-22(17-24(23)37-2)39(34,35)32(18-20-9-5-3-6-10-20)19-25(33)28-15-16-38-27-29-26(30-31-27)21-11-7-4-8-12-21/h3-14,17H,15-16,18-19H2,1-2H3,(H,28,33)(H,29,30,31) |
| InChIKey | XVGWFBJWRXNPPJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|