C17H22N4OS — CID 3906065
N-cycloheptyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 3906065) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is N-cycloheptyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-cycloheptyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3906065 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-cycloheptyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(-c2ccccc2)n1)NC1CCCCCC1 |
| InChI | InChI=1S/C17H22N4OS/c22-15(18-14-10-6-1-2-7-11-14)12-23-17-19-16(20-21-17)13-8-4-3-5-9-13/h3-5,8-9,14H,1-2,6-7,10-12H2,(H,18,22)(H,19,20,21) |
| InChIKey | LFFRRWWYSNEAAE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |