C19H24N4OS — CID 8848575
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 8848575) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 8848575 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | O=C(CSc1n[nH]c(-c2ccccc2)n1)N1CC[C@@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C19H24N4OS/c24-17(23-11-10-14-6-4-5-9-16(14)12-23)13-25-19-20-18(21-22-19)15-7-2-1-3-8-15/h1-3,7-8,14,16H,4-6,9-13H2,(H,20,21,22)/t14-,16-/m0/s1 |
| InChIKey | FGVJIZVWLULNCH-HOCLYGCPSA-N |
| XLogP | 3.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |