C18H24N4OS — CID 5019410
N-cyclooctyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 5019410) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N-cyclooctyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-cyclooctyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 5019410 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-cyclooctyl-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(-c2ccccc2)n1)NC1CCCCCCC1 |
| InChI | InChI=1S/C18H24N4OS/c23-16(19-15-11-7-2-1-3-8-12-15)13-24-18-20-17(21-22-18)14-9-5-4-6-10-14/h4-6,9-10,15H,1-3,7-8,11-13H2,(H,19,23)(H,20,21,22) |
| InChIKey | HNBMLQKHXLXUMF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |