C14H18FN5O3S2 — CID 100796860
2-[ethyl-(4-fluorophenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide (PubChem CID 100796860) has the molecular formula C14H18FN5O3S2 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[ethyl-(4-fluorophenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[ethyl-(4-fluorophenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 100796860 |
| Molecular Formula | C14H18FN5O3S2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[ethyl-(4-fluorophenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
| SMILES | CCN(CC(=O)NCCSc1ncn[nH]1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN5O3S2/c1-2-20(25(22,23)12-5-3-11(15)4-6-12)9-13(21)16-7-8-24-14-17-10-18-19-14/h3-6,10H,2,7-9H2,1H3,(H,16,21)(H,17,18,19) |
| InChIKey | QNBONBZEPIUGSK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|