C21H25N5O3S2 — CID 100781708
2-[benzyl-(2,5-dimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide (PubChem CID 100781708) has the molecular formula C21H25N5O3S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is 2-[benzyl-(2,5-dimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[benzyl-(2,5-dimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 100781708 |
| Molecular Formula | C21H25N5O3S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[benzyl-(2,5-dimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N(CC(=O)NCCSc2ncn[nH]2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H25N5O3S2/c1-16-8-9-17(2)19(12-16)31(28,29)26(13-18-6-4-3-5-7-18)14-20(27)22-10-11-30-21-23-15-24-25-21/h3-9,12,15H,10-11,13-14H2,1-2H3,(H,22,27)(H,23,24,25) |
| InChIKey | VFSKCPVRRXPCSL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|