C16H23N5O3S2 — CID 100794530
2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide (PubChem CID 100794530) has the molecular formula C16H23N5O3S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 100794530 |
| Molecular Formula | C16H23N5O3S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[methyl-(2,4,6-trimethylphenyl)sulfonylamino]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C)CC(=O)NCCSc2ncn[nH]2)c(C)c1 |
| InChI | InChI=1S/C16H23N5O3S2/c1-11-7-12(2)15(13(3)8-11)26(23,24)21(4)9-14(22)17-5-6-25-16-18-10-19-20-16/h7-8,10H,5-6,9H2,1-4H3,(H,17,22)(H,18,19,20) |
| InChIKey | LJVAQOJFWLYPBO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|